C20H26FN5O — CID 154580953
2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-4-pyrrolidin-1-ylpyrimidine (PubChem CID 154580953) has the molecular formula C20H26FN5O and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-4-pyrrolidin-1-ylpyrimidine.
| Compound Name | 2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-4-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 154580953 |
| Molecular Formula | C20H26FN5O |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-4-pyrrolidin-1-ylpyrimidine |
| SMILES | COc1ccc(CN2CCN(c3nccc(N4CCCC4)n3)CC2)cc1F |
| InChI | InChI=1S/C20H26FN5O/c1-27-18-5-4-16(14-17(18)21)15-24-10-12-26(13-11-24)20-22-7-6-19(23-20)25-8-2-3-9-25/h4-7,14H,2-3,8-13,15H2,1H3 |
| InChIKey | JBLHBZMBQUCXCL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |