C21H19F3N2O4S — CID 15458206
5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-ethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 15458206) has the molecular formula C21H19F3N2O4S and a molecular weight of 452.45 g/mol. Its IUPAC name is 5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-ethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-ethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 15458206 |
| Molecular Formula | C21H19F3N2O4S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-ethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | CCOc1ccc(CC2SC(=O)NC2=O)cc1C(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N2O4S/c1-2-30-16-8-5-13(10-17-19(28)26-20(29)31-17)9-15(16)18(27)25-11-12-3-6-14(7-4-12)21(22,23)24/h3-9,17H,2,10-11H2,1H3,(H,25,27)(H,26,28,29) |
| InChIKey | TZEKAHPPDSJJMA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|