C21H26FN5O2 — CID 154582354
9-(1,5-dimethylpyrazole-3-carbonyl)-2-[(4-fluorophenyl)methyl]-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one (PubChem CID 154582354) has the molecular formula C21H26FN5O2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 9-(1,5-dimethylpyrazole-3-carbonyl)-2-[(4-fluorophenyl)methyl]-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one.
| Compound Name | 9-(1,5-dimethylpyrazole-3-carbonyl)-2-[(4-fluorophenyl)methyl]-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one |
|---|---|
| PubChem CID | 154582354 |
| Molecular Formula | C21H26FN5O2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 9-(1,5-dimethylpyrazole-3-carbonyl)-2-[(4-fluorophenyl)methyl]-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one |
| SMILES | Cc1cc(C(=O)N2CCCN3CCN(Cc4ccc(F)cc4)C(=O)C3C2)nn1C |
| InChI | InChI=1S/C21H26FN5O2/c1-15-12-18(23-24(15)2)20(28)26-9-3-8-25-10-11-27(21(29)19(25)14-26)13-16-4-6-17(22)7-5-16/h4-7,12,19H,3,8-11,13-14H2,1-2H3 |
| InChIKey | AHPOICFCLPTPLD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |