C9H17ClN4 — CID 154582392
4-(4,5-dimethyltriazol-2-yl)piperidine;hydrochloride (PubChem CID 154582392) has the molecular formula C9H17ClN4 and a molecular weight of 216.72 g/mol. Its IUPAC name is 4-(4,5-dimethyltriazol-2-yl)piperidine;hydrochloride.
| Compound Name | 4-(4,5-dimethyltriazol-2-yl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 154582392 |
| Molecular Formula | C9H17ClN4 |
| Molecular Weight | 216.72 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 4-(4,5-dimethyltriazol-2-yl)piperidine;hydrochloride |
| SMILES | Cc1nn(C2CCNCC2)nc1C.Cl |
| InChI | InChI=1S/C9H16N4.ClH/c1-7-8(2)12-13(11-7)9-3-5-10-6-4-9;/h9-10H,3-6H2,1-2H3;1H |
| InChIKey | BMXZMIFASYRWNT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |