About N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride
N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride (PubChem CID 154582399) has the molecular formula C13H22Cl2N6
and a molecular weight of 333.27 g/mol. Its IUPAC name is N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride |
| PubChem CID | 154582399 |
| Molecular Formula | C13H22Cl2N6 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride |
| SMILES | CN(CC1CCNCC1)c1ncnc2c1cnn2C.Cl.Cl |
| InChI | InChI=1S/C13H20N6.2ClH/c1-18(8-10-3-5-14-6-4-10)12-11-7-17-19(2)13(11)16-9-15-12;;/h7,9-10,14H,3-6,8H2,1-2H3;2*1H |
| InChIKey | ZWLHCJOULAJEQS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride?
The IUPAC name of N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride (CID 154582399) is N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride.
What is the SMILES notation for N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride?
The canonical SMILES for N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride is CN(CC1CCNCC1)c1ncnc2c1cnn2C.Cl.Cl.
What is the InChIKey of N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride?
The InChIKey is ZWLHCJOULAJEQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6.2ClH/c1-18(8-10-3-5-14-6-4-10)12-11-7-17-19(2)13(11)16-9-15-12;;/h7,9-10,14H,3-6,8H2,1-2H3;2*1H.
What are the key properties of N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride?
N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride has a molecular weight of 333.27 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dimethyl-N-(piperidin-4-ylmethyl)pyrazolo[5,4-d]pyrimidin-4-amine;dihydrochloride is sourced from PubChem (CID 154582399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).