C10H15FN4O2S — CID 154582512
N-[[1-(5-fluoropyrimidin-2-yl)azetidin-3-yl]methyl]-N-methylmethanesulfonamide (PubChem CID 154582512) has the molecular formula C10H15FN4O2S and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[[1-(5-fluoropyrimidin-2-yl)azetidin-3-yl]methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[[1-(5-fluoropyrimidin-2-yl)azetidin-3-yl]methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 154582512 |
| Molecular Formula | C10H15FN4O2S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-[[1-(5-fluoropyrimidin-2-yl)azetidin-3-yl]methyl]-N-methylmethanesulfonamide |
| SMILES | CN(CC1CN(c2ncc(F)cn2)C1)S(C)(=O)=O |
| InChI | InChI=1S/C10H15FN4O2S/c1-14(18(2,16)17)5-8-6-15(7-8)10-12-3-9(11)4-13-10/h3-4,8H,5-7H2,1-2H3 |
| InChIKey | LSRASPFJNHECOA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |