About tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate
tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate (PubChem CID 15458319) has the molecular formula C23H21F6NO3
and a molecular weight of 473.41 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate |
| PubChem CID | 15458319 |
| Molecular Formula | C23H21F6NO3 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)/C=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C23H21F6NO3/c1-21(2,3)33-20(32)30-19(15-7-5-4-6-8-15)18(31)10-9-14-11-16(22(24,25)26)13-17(12-14)23(27,28)29/h4-13,19H,1-3H3,(H,30,32)/b10-9+ |
| InChIKey | JDJUXEBWGNEEDT-MDZDMXLPSA-N |
| XLogP | 6.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate?
The IUPAC name of tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate (CID 15458319) is tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate.
What is the SMILES notation for tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate?
The canonical SMILES for tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate is CC(C)(C)OC(=O)NC(C(=O)/C=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1.
What is the InChIKey of tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate?
The InChIKey is JDJUXEBWGNEEDT-MDZDMXLPSA-N. The full InChI is InChI=1S/C23H21F6NO3/c1-21(2,3)33-20(32)30-19(15-7-5-4-6-8-15)18(31)10-9-14-11-16(22(24,25)26)13-17(12-14)23(27,28)29/h4-13,19H,1-3H3,(H,30,32)/b10-9+.
What are the key properties of tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate?
tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate has a molecular weight of 473.41 g/mol, XLogP of 6.57, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(E)-4-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-1-phenylbut-3-enyl]carbamate is sourced from PubChem (CID 15458319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).