About methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate
methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate (PubChem CID 15458375) has the molecular formula C17H13N3O5
and a molecular weight of 339.31 g/mol. Its IUPAC name is methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate |
| PubChem CID | 15458375 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(-c2ccc3c(n2)C(=O)C(N)=C(OC)C3=O)n1 |
| InChI | InChI=1S/C17H13N3O5/c1-24-16-12(18)15(22)13-8(14(16)21)6-7-10(20-13)9-4-3-5-11(19-9)17(23)25-2/h3-7H,18H2,1-2H3 |
| InChIKey | PMYYPYYHACQMIU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate?
The IUPAC name of methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate (CID 15458375) is methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate?
The canonical SMILES for methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate is COC(=O)c1cccc(-c2ccc3c(n2)C(=O)C(N)=C(OC)C3=O)n1.
What is the InChIKey of methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate?
The InChIKey is PMYYPYYHACQMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O5/c1-24-16-12(18)15(22)13-8(14(16)21)6-7-10(20-13)9-4-3-5-11(19-9)17(23)25-2/h3-7H,18H2,1-2H3.
What are the key properties of methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate?
methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate has a molecular weight of 339.31 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)pyridine-2-carboxylate is sourced from PubChem (CID 15458375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).