C20H34N3O8S- — CID 154584285
(2R)-2-[[(2R)-2-(cyclohexyloxycarbonylamino)-4-methylpentanoyl]amino]-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propane-1-sulfonate (PubChem CID 154584285) has the molecular formula C20H34N3O8S- and a molecular weight of 476.57 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-(cyclohexyloxycarbonylamino)-4-methylpentanoyl]amino]-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propane-1-sulfonate.
| Compound Name | (2R)-2-[[(2R)-2-(cyclohexyloxycarbonylamino)-4-methylpentanoyl]amino]-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 154584285 |
| Molecular Formula | C20H34N3O8S- |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | (2R)-2-[[(2R)-2-(cyclohexyloxycarbonylamino)-4-methylpentanoyl]amino]-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propane-1-sulfonate |
| SMILES | CC(C)C[C@@H](NC(=O)OC1CCCCC1)C(=O)N[C@H](CC1CCNC1=O)C(O)S(=O)(=O)[O-] |
| InChI | InChI=1S/C20H35N3O8S/c1-12(2)10-15(23-20(27)31-14-6-4-3-5-7-14)18(25)22-16(19(26)32(28,29)30)11-13-8-9-21-17(13)24/h12-16,19,26H,3-11H2,1-2H3,(H,21,24)(H,22,25)(H,23,27)(H,28,29,30)/p-1/t13?,15-,16-,19?/m1/s1 |
| InChIKey | ORKNIPZHPCWIDI-BYGOXVSRSA-M |
| XLogP | 0.33 |
| TPSA | 173.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|