C24H33N5O2 — CID 154584648
8-[[4-(1,2-benzoxazol-5-yl)piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one (PubChem CID 154584648) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 8-[[4-(1,2-benzoxazol-5-yl)piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one.
| Compound Name | 8-[[4-(1,2-benzoxazol-5-yl)piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 154584648 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 8-[[4-(1,2-benzoxazol-5-yl)piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one |
| SMILES | O=C1NC2CC(CN3CCN(c4ccc5oncc5c4)CC3)CCC2C2NCCCC12 |
| InChI | InChI=1S/C24H33N5O2/c30-24-20-2-1-7-25-23(20)19-5-3-16(12-21(19)27-24)15-28-8-10-29(11-9-28)18-4-6-22-17(13-18)14-26-31-22/h4,6,13-14,16,19-21,23,25H,1-3,5,7-12,15H2,(H,27,30) |
| InChIKey | QFZVEWFENCFJCF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |