C23H32N6O2 — CID 154584650
8-[[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one (PubChem CID 154584650) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 8-[[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one.
| Compound Name | 8-[[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 154584650 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 8-[[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one |
| SMILES | O=C1NC2CC(CN3CCN(c4nc5cccnc5o4)CC3)CCC2C2NCCCC12 |
| InChI | InChI=1S/C23H32N6O2/c30-21-17-3-1-7-24-20(17)16-6-5-15(13-19(16)26-21)14-28-9-11-29(12-10-28)23-27-18-4-2-8-25-22(18)31-23/h2,4,8,15-17,19-20,24H,1,3,5-7,9-14H2,(H,26,30) |
| InChIKey | CCGLAWWUZKGXNR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |