C19H15FN4O3 — CID 154584698
(11R)-7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-fluoro-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (PubChem CID 154584698) has the molecular formula C19H15FN4O3 and a molecular weight of 366.35 g/mol. Its IUPAC name is (11R)-7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-fluoro-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one.
| Compound Name | (11R)-7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-fluoro-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
|---|---|
| PubChem CID | 154584698 |
| Molecular Formula | C19H15FN4O3 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (11R)-7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-fluoro-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| SMILES | Cc1noc(C)c1-c1cc(F)c2[nH]c(=O)n3c2c1OC[C@H]3c1ccccn1 |
| InChI | InChI=1S/C19H15FN4O3/c1-9-15(10(2)27-23-9)11-7-12(20)16-17-18(11)26-8-14(24(17)19(25)22-16)13-5-3-4-6-21-13/h3-7,14H,8H2,1-2H3,(H,22,25)/t14-/m0/s1 |
| InChIKey | MTPNAAAJRMAHMJ-AWEZNQCLSA-N |
| XLogP | 3.12 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |