C21H15N3O2 — CID 154585288
14-amino-18-phenyl-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one (PubChem CID 154585288) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 14-amino-18-phenyl-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one.
| Compound Name | 14-amino-18-phenyl-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one |
|---|---|
| PubChem CID | 154585288 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 14-amino-18-phenyl-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)C(c1ccccc1)c1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C21H15N3O2/c22-21-23-19(25)18-16(13-7-2-1-3-8-13)17-14-9-5-4-6-12(14)10-11-15(17)26-20(18)24-21/h1-11,16H,(H3,22,23,24,25) |
| InChIKey | GXIRTIFLXFLTSX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |