C21H14ClN3O2 — CID 154585304
15-amino-11-(4-chlorophenyl)-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-one (PubChem CID 154585304) has the molecular formula C21H14ClN3O2 and a molecular weight of 375.82 g/mol. Its IUPAC name is 15-amino-11-(4-chlorophenyl)-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-one.
| Compound Name | 15-amino-11-(4-chlorophenyl)-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-one |
|---|---|
| PubChem CID | 154585304 |
| Molecular Formula | C21H14ClN3O2 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 15-amino-11-(4-chlorophenyl)-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)C(c1ccc(Cl)cc1)c1ccc3ccccc3c1O2 |
| InChI | InChI=1S/C21H14ClN3O2/c22-13-8-5-12(6-9-13)16-15-10-7-11-3-1-2-4-14(11)18(15)27-20-17(16)19(26)24-21(23)25-20/h1-10,16H,(H3,23,24,25,26) |
| InChIKey | NRPOESUYXFZFKI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |