C31H26FeN2 — CID 154585361
cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-yl-9-(2,4,6-trimethylphenyl)-1,10-phenanthroline;iron(2+) (PubChem CID 154585361) has the molecular formula C31H26FeN2 and a molecular weight of 482.41 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-yl-9-(2,4,6-trimethylphenyl)-1,10-phenanthroline;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-yl-9-(2,4,6-trimethylphenyl)-1,10-phenanthroline;iron(2+) |
|---|---|
| PubChem CID | 154585361 |
| Molecular Formula | C31H26FeN2 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-yl-9-(2,4,6-trimethylphenyl)-1,10-phenanthroline;iron(2+) |
| SMILES | Cc1cc(C)c(-c2ccc3ccc4ccc(-[c-]5cccc5)nc4c3n2)c(C)c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C26H21N2.C5H5.Fe/c1-16-14-17(2)24(18(3)15-16)23-13-11-21-9-8-20-10-12-22(19-6-4-5-7-19)27-25(20)26(21)28-23;1-2-4-5-3-1;/h4-15H,1-3H3;1-5H;/q2*-1;+2 |
| InChIKey | OKKVSKUBFLHTSM-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|