C13H22O4 — CID 154585823
(4S)-4-[(Z)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-2,2,4-trimethyl-1,3-dioxolane (PubChem CID 154585823) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (4S)-4-[(Z)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-2,2,4-trimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(Z)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-2,2,4-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 154585823 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (4S)-4-[(Z)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-2,2,4-trimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@H](/C=C\[C@@]2(C)COC(C)(C)O2)O1 |
| InChI | InChI=1S/C13H22O4/c1-11(2)14-8-10(16-11)6-7-13(5)9-15-12(3,4)17-13/h6-7,10H,8-9H2,1-5H3/b7-6-/t10-,13-/m0/s1 |
| InChIKey | AYDSLNMMDSHPQC-AKFPGXAZSA-N |
| XLogP | 2.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|