C39H72NO2P — CID 154586029
(tetrabutyl-λ5-phosphanyl) (Z)-18-pyridin-2-yloctadec-9-enoate (PubChem CID 154586029) has the molecular formula C39H72NO2P and a molecular weight of 617.98 g/mol. Its IUPAC name is (tetrabutyl-λ5-phosphanyl) (Z)-18-pyridin-2-yloctadec-9-enoate.
| Compound Name | (tetrabutyl-λ5-phosphanyl) (Z)-18-pyridin-2-yloctadec-9-enoate |
|---|---|
| PubChem CID | 154586029 |
| Molecular Formula | C39H72NO2P |
| Molecular Weight | 617.98 g/mol |
| Exact Mass | 617.53 |
| IUPAC Name | (tetrabutyl-λ5-phosphanyl) (Z)-18-pyridin-2-yloctadec-9-enoate |
| SMILES | CCCCP(CCCC)(CCCC)(CCCC)OC(=O)CCCCCCC/C=C\CCCCCCCCc1ccccn1 |
| InChI | InChI=1S/C39H72NO2P/c1-5-9-34-43(35-10-6-2,36-11-7-3,37-12-8-4)42-39(41)32-27-25-23-21-19-17-15-13-14-16-18-20-22-24-26-30-38-31-28-29-33-40-38/h13,15,28-29,31,33H,5-12,14,16-27,30,32,34-37H2,1-4H3/b15-13- |
| InChIKey | LHLYLPARGISOEE-SQFISAMPSA-N |
| XLogP | 12.85 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.98 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|