C15H20ClN3O2 — CID 154586680
3-N-[(1R,2S)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide;hydrochloride (PubChem CID 154586680) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 3-N-[(1R,2S)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide;hydrochloride.
| Compound Name | 3-N-[(1R,2S)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 154586680 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-N-[(1R,2S)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1CNCC1C(=O)N[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H19N3O2.ClH/c16-14(19)11-7-17-8-12(11)15(20)18-13-6-10(13)9-4-2-1-3-5-9;/h1-5,10-13,17H,6-8H2,(H2,16,19)(H,18,20);1H/t10-,11?,12?,13+;/m0./s1 |
| InChIKey | KNRQAXMNFSZHAI-RVSMYKNHSA-N |
| XLogP | 0.40 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |