C18H25NO2 — CID 15458698
(4S,5R)-5-(cyclohexylmethyl)-4-phenylmethoxypyrrolidin-2-one (PubChem CID 15458698) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (4S,5R)-5-(cyclohexylmethyl)-4-phenylmethoxypyrrolidin-2-one.
| Compound Name | (4S,5R)-5-(cyclohexylmethyl)-4-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 15458698 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (4S,5R)-5-(cyclohexylmethyl)-4-phenylmethoxypyrrolidin-2-one |
| SMILES | O=C1C[C@H](OCc2ccccc2)[C@@H](CC2CCCCC2)N1 |
| InChI | InChI=1S/C18H25NO2/c20-18-12-17(21-13-15-9-5-2-6-10-15)16(19-18)11-14-7-3-1-4-8-14/h2,5-6,9-10,14,16-17H,1,3-4,7-8,11-13H2,(H,19,20)/t16-,17+/m1/s1 |
| InChIKey | PHCXPTBIMHMOKZ-SJORKVTESA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |