C19H19N — CID 15458731
1,3,3-trimethyl-4,11-dihydroindeno[2,1-f]quinoline (PubChem CID 15458731) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 1,3,3-trimethyl-4,11-dihydroindeno[2,1-f]quinoline.
| Compound Name | 1,3,3-trimethyl-4,11-dihydroindeno[2,1-f]quinoline |
|---|---|
| PubChem CID | 15458731 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1,3,3-trimethyl-4,11-dihydroindeno[2,1-f]quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc3c(c21)Cc1ccccc1-3 |
| InChI | InChI=1S/C19H19N/c1-12-11-19(2,3)20-17-9-8-15-14-7-5-4-6-13(14)10-16(15)18(12)17/h4-9,11,20H,10H2,1-3H3 |
| InChIKey | XIEOFCDTJAVROO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |