C19H18BrN — CID 15458734
8-bromo-2,2,4-trimethyl-1,10-dihydroindeno[1,2-g]quinoline (PubChem CID 15458734) has the molecular formula C19H18BrN and a molecular weight of 340.26 g/mol. Its IUPAC name is 8-bromo-2,2,4-trimethyl-1,10-dihydroindeno[1,2-g]quinoline.
| Compound Name | 8-bromo-2,2,4-trimethyl-1,10-dihydroindeno[1,2-g]quinoline |
|---|---|
| PubChem CID | 15458734 |
| Molecular Formula | C19H18BrN |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 8-bromo-2,2,4-trimethyl-1,10-dihydroindeno[1,2-g]quinoline |
| SMILES | CC1=CC(C)(C)Nc2cc3c(cc21)-c1ccc(Br)cc1C3 |
| InChI | InChI=1S/C19H18BrN/c1-11-10-19(2,3)21-18-8-13-6-12-7-14(20)4-5-15(12)17(13)9-16(11)18/h4-5,7-10,21H,6H2,1-3H3 |
| InChIKey | GVOMUZMTQPGWTA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |