C20H21NO — CID 15458738
(2,2,4-trimethyl-1,10-dihydroindeno[1,2-g]quinolin-9-yl)methanol (PubChem CID 15458738) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (2,2,4-trimethyl-1,10-dihydroindeno[1,2-g]quinolin-9-yl)methanol.
| Compound Name | (2,2,4-trimethyl-1,10-dihydroindeno[1,2-g]quinolin-9-yl)methanol |
|---|---|
| PubChem CID | 15458738 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2,2,4-trimethyl-1,10-dihydroindeno[1,2-g]quinolin-9-yl)methanol |
| SMILES | CC1=CC(C)(C)Nc2cc3c(cc21)-c1cccc(CO)c1C3 |
| InChI | InChI=1S/C20H21NO/c1-12-10-20(2,3)21-19-8-14-7-17-13(11-22)5-4-6-15(17)18(14)9-16(12)19/h4-6,8-10,21-22H,7,11H2,1-3H3 |
| InChIKey | YENMITWCIGMYGV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |