C18H18N2 — CID 15458746
2,2,4-trimethyl-1,10-dihydropyrido[2,3-b]carbazole (PubChem CID 15458746) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2,2,4-trimethyl-1,10-dihydropyrido[2,3-b]carbazole.
| Compound Name | 2,2,4-trimethyl-1,10-dihydropyrido[2,3-b]carbazole |
|---|---|
| PubChem CID | 15458746 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2,2,4-trimethyl-1,10-dihydropyrido[2,3-b]carbazole |
| SMILES | CC1=CC(C)(C)Nc2cc3[nH]c4ccccc4c3cc21 |
| InChI | InChI=1S/C18H18N2/c1-11-10-18(2,3)20-17-9-16-14(8-13(11)17)12-6-4-5-7-15(12)19-16/h4-10,19-20H,1-3H3 |
| InChIKey | ZKBIYCLPMIOTJI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |