C31H26IrN2S-2 — CID 154587813
2-(4H-1-benzothionin-4-id-3-yl)-3,4,5,6-tetradeuteriopyridine;2-(4-cyclopropylcyclohexa-1,3-dien-1-yl)pyridine;iridium (PubChem CID 154587813) has the molecular formula C31H26IrN2S-2 and a molecular weight of 654.87 g/mol. Its IUPAC name is 2-(4H-1-benzothionin-4-id-3-yl)-3,4,5,6-tetradeuteriopyridine;2-(4-cyclopropylcyclohexa-1,3-dien-1-yl)pyridine;iridium.
| Compound Name | 2-(4H-1-benzothionin-4-id-3-yl)-3,4,5,6-tetradeuteriopyridine;2-(4-cyclopropylcyclohexa-1,3-dien-1-yl)pyridine;iridium |
|---|---|
| PubChem CID | 154587813 |
| Molecular Formula | C31H26IrN2S-2 |
| Molecular Weight | 654.87 g/mol |
| Exact Mass | 655.17 |
| IUPAC Name | 2-(4H-1-benzothionin-4-id-3-yl)-3,4,5,6-tetradeuteriopyridine;2-(4-cyclopropylcyclohexa-1,3-dien-1-yl)pyridine;iridium |
| SMILES | C1=C(c2ccccn2)[CH-]CC(C2CC2)=C1.[2H]c1nc(-c2[c-]cccc3ccccc3sc2)c([2H])c([2H])c1[2H].[Ir] |
| InChI | InChI=1S/C17H12NS.C14H14N.Ir/c1-2-9-15(16-10-5-6-12-18-16)13-19-17-11-4-3-8-14(17)7-1;1-2-10-15-14(3-1)13-8-6-12(7-9-13)11-4-5-11;/h1-8,10-13H;1-3,6,8-11H,4-5,7H2;/q2*-1;/b7-1-,15-13+;;/i5D,6D,10D,12D;; |
| InChIKey | WBUXBGSPNHNMGA-MINKGNGCSA-N |
| XLogP | 8.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.87 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|