C29H27IrN3O-2 — CID 154587916
2-hexa-1,5-dien-2-yl-5-methylpyridine;iridium;1,2,3-trideuterio-N-[2-deuterio-1-[2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-id-8-yl]ethenyl]prop-2-en-1-imine (PubChem CID 154587916) has the molecular formula C29H27IrN3O-2 and a molecular weight of 632.81 g/mol. Its IUPAC name is 2-hexa-1,5-dien-2-yl-5-methylpyridine;iridium;1,2,3-trideuterio-N-[2-deuterio-1-[2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-id-8-yl]ethenyl]prop-2-en-1-imine.
| Compound Name | 2-hexa-1,5-dien-2-yl-5-methylpyridine;iridium;1,2,3-trideuterio-N-[2-deuterio-1-[2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-id-8-yl]ethenyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 154587916 |
| Molecular Formula | C29H27IrN3O-2 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | 2-hexa-1,5-dien-2-yl-5-methylpyridine;iridium;1,2,3-trideuterio-N-[2-deuterio-1-[2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-id-8-yl]ethenyl]prop-2-en-1-imine |
| SMILES | C=CC[CH-]C(=C)c1ccc(C)cn1.[2H]/C=C([2H])/C([2H])=N\C(=C\[2H])c1[c-]ccc2c1oc1nc(C([2H])([2H])[2H])ccc12.[Ir] |
| InChI | InChI=1S/C17H13N2O.C12H14N.Ir/c1-4-10-18-12(3)13-6-5-7-14-15-9-8-11(2)19-17(15)20-16(13)14;1-4-5-6-11(3)12-8-7-10(2)9-13-12;/h4-5,7-10H,1,3H2,2H3;4,6-9H,1,3,5H2,2H3;/q2*-1;/b18-10-;;/i1D,2D3,3D,4D,10D;;/b4-1+,12-3+,18-10-;; |
| InChIKey | RGDSAHLLTMQOCM-UAJIYHRXSA-N |
| XLogP | 7.50 |
| TPSA | 51.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|