C18H13NO — CID 154588250
3,4-dideuterio-2-dibenzofuran-4-yl-5-methylpyridine (PubChem CID 154588250) has the molecular formula C18H13NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 3,4-dideuterio-2-dibenzofuran-4-yl-5-methylpyridine.
| Compound Name | 3,4-dideuterio-2-dibenzofuran-4-yl-5-methylpyridine |
|---|---|
| PubChem CID | 154588250 |
| Molecular Formula | C18H13NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 3,4-dideuterio-2-dibenzofuran-4-yl-5-methylpyridine |
| SMILES | [2H]c1c(C)cnc(-c2cccc3c2oc2ccccc23)c1[2H] |
| InChI | InChI=1S/C18H13NO/c1-12-9-10-16(19-11-12)15-7-4-6-14-13-5-2-3-8-17(13)20-18(14)15/h2-11H,1H3/i9D,10D |
| InChIKey | IPPZCDYMTVOYQD-QDRJLNDYSA-N |
| XLogP | 4.96 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |