C19H20N4O — CID 154588348
2-[4-(5,5-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide (PubChem CID 154588348) has the molecular formula C19H20N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[4-(5,5-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide.
| Compound Name | 2-[4-(5,5-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 154588348 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[4-(5,5-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide |
| SMILES | [2H]C1([2H])CNCC(c2ccc(-n3cc4cccc(C(N)=O)c4n3)cc2)C1 |
| InChI | InChI=1S/C19H20N4O/c20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14/h1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24)/i2D2 |
| InChIKey | PCHKPVIQAHNQLW-CBTSVUPCSA-N |
| XLogP | 2.59 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |