C49H34F3N3O4S — CID 154588821
[3-[4,5-dimethyl-2-(4-pyridin-2-ylphenyl)phenyl]-5-[2-[6-(2-methyl-[1]benzofuro[2,3-b]pyridin-8-yl)-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 154588821) has the molecular formula C49H34F3N3O4S and a molecular weight of 817.89 g/mol. Its IUPAC name is [3-[4,5-dimethyl-2-(4-pyridin-2-ylphenyl)phenyl]-5-[2-[6-(2-methyl-[1]benzofuro[2,3-b]pyridin-8-yl)-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[4,5-dimethyl-2-(4-pyridin-2-ylphenyl)phenyl]-5-[2-[6-(2-methyl-[1]benzofuro[2,3-b]pyridin-8-yl)-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154588821 |
| Molecular Formula | C49H34F3N3O4S |
| Molecular Weight | 817.89 g/mol |
| Exact Mass | 817.22 |
| IUPAC Name | [3-[4,5-dimethyl-2-(4-pyridin-2-ylphenyl)phenyl]-5-[2-[6-(2-methyl-[1]benzofuro[2,3-b]pyridin-8-yl)-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc2c(n1)oc1c(-c3ccc(-c4ccccc4-c4cc(OS(=O)(=O)C(F)(F)F)cc(-c5cc(C)c(C)cc5-c5ccc(-c6ccccn6)cc5)c4)cn3)cccc12 |
| InChI | InChI=1S/C49H34F3N3O4S/c1-29-23-43(32-15-17-33(18-16-32)45-13-6-7-22-53-45)44(24-30(29)2)36-25-35(26-37(27-36)59-60(56,57)49(50,51)52)39-10-5-4-9-38(39)34-19-21-46(54-28-34)42-12-8-11-40-41-20-14-31(3)55-48(41)58-47(40)42/h4-28H,1-3H3 |
| InChIKey | AMIASYJOUFHLMD-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 95.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.89 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|