C32H32ClN7O5S — CID 154589000
10-[[2-[bis[(3,4-dimethoxyphenyl)methyl]amino]pyrimidin-4-yl]methyl]-4-(chloromethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 154589000) has the molecular formula C32H32ClN7O5S and a molecular weight of 662.17 g/mol. Its IUPAC name is 10-[[2-[bis[(3,4-dimethoxyphenyl)methyl]amino]pyrimidin-4-yl]methyl]-4-(chloromethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-[[2-[bis[(3,4-dimethoxyphenyl)methyl]amino]pyrimidin-4-yl]methyl]-4-(chloromethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 154589000 |
| Molecular Formula | C32H32ClN7O5S |
| Molecular Weight | 662.17 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | 10-[[2-[bis[(3,4-dimethoxyphenyl)methyl]amino]pyrimidin-4-yl]methyl]-4-(chloromethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | COc1ccc(CN(Cc2ccc(OC)c(OC)c2)c2nccc(Cn3ncc4c5sc(CCl)nc5n(C)c4c3=O)n2)cc1OC |
| InChI | InChI=1S/C32H32ClN7O5S/c1-38-28-22(29-30(38)37-27(14-33)46-29)15-35-40(31(28)41)18-21-10-11-34-32(36-21)39(16-19-6-8-23(42-2)25(12-19)44-4)17-20-7-9-24(43-3)26(13-20)45-5/h6-13,15H,14,16-18H2,1-5H3 |
| InChIKey | UCJMDQCXQHZDJQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 118.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.17 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|