C17H14N8OS — CID 154589003
10-benzyl-7-methyl-4-(2H-tetrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 154589003) has the molecular formula C17H14N8OS and a molecular weight of 378.42 g/mol. Its IUPAC name is 10-benzyl-7-methyl-4-(2H-tetrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-benzyl-7-methyl-4-(2H-tetrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 154589003 |
| Molecular Formula | C17H14N8OS |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 10-benzyl-7-methyl-4-(2H-tetrazol-5-ylmethyl)-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | Cn1c2nc(Cc3nn[nH]n3)sc2c2cnn(Cc3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C17H14N8OS/c1-24-14-11(8-18-25(17(14)26)9-10-5-3-2-4-6-10)15-16(24)19-13(27-15)7-12-20-22-23-21-12/h2-6,8H,7,9H2,1H3,(H,20,21,22,23) |
| InChIKey | LNCLUAOCJLVJHA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |