About (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine
(4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine (PubChem CID 154589289) has the molecular formula C4H8BrN3
and a molecular weight of 178.03 g/mol. Its IUPAC name is (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine.
Molecular Properties
| Compound Name | (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine |
| PubChem CID | 154589289 |
| Molecular Formula | C4H8BrN3 |
| Molecular Weight | 178.03 g/mol |
| Exact Mass | 176.99 |
| IUPAC Name | (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine |
| SMILES | C[C@@H]1NNNC=C1Br |
| InChI | InChI=1S/C4H8BrN3/c1-3-4(5)2-6-8-7-3/h2-3,6-8H,1H3/t3-/m0/s1 |
| InChIKey | JGLKGEFWBIOUNJ-VKHMYHEASA-N |
| XLogP | 0.22 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.03 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine?
The IUPAC name of (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine (CID 154589289) is (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine.
What is the SMILES notation for (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine?
The canonical SMILES for (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine is C[C@@H]1NNNC=C1Br.
What is the InChIKey of (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine?
The InChIKey is JGLKGEFWBIOUNJ-VKHMYHEASA-N. The full InChI is InChI=1S/C4H8BrN3/c1-3-4(5)2-6-8-7-3/h2-3,6-8H,1H3/t3-/m0/s1.
What are the key properties of (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine?
(4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine has a molecular weight of 178.03 g/mol, XLogP of 0.22, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5-bromo-4-methyl-1,2,3,4-tetrahydrotriazine is sourced from PubChem (CID 154589289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).