About 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline
4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline (PubChem CID 154589558) has the molecular formula C23H18F3N
and a molecular weight of 365.40 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline.
Molecular Properties
| Compound Name | 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline |
| PubChem CID | 154589558 |
| Molecular Formula | C23H18F3N |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline |
| SMILES | Cc1cc(C)cc(-c2nccc3c2ccc2c(C)cc(C(F)(F)F)cc23)c1 |
| InChI | InChI=1S/C23H18F3N/c1-13-8-14(2)10-16(9-13)22-20-5-4-18-15(3)11-17(23(24,25)26)12-21(18)19(20)6-7-27-22/h4-12H,1-3H3 |
| InChIKey | GVODZEGXZGKKAK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline?
The IUPAC name of 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline (CID 154589558) is 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline.
What is the SMILES notation for 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline?
The canonical SMILES for 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline is Cc1cc(C)cc(-c2nccc3c2ccc2c(C)cc(C(F)(F)F)cc23)c1.
What is the InChIKey of 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline?
The InChIKey is GVODZEGXZGKKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F3N/c1-13-8-14(2)10-16(9-13)22-20-5-4-18-15(3)11-17(23(24,25)26)12-21(18)19(20)6-7-27-22/h4-12H,1-3H3.
What are the key properties of 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline?
4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline has a molecular weight of 365.40 g/mol, XLogP of 7.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylphenyl)-7-methyl-9-(trifluoromethyl)benzo[f]isoquinoline is sourced from PubChem (CID 154589558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).