C25H32N6O4 — CID 15459061
tert-butyl N-[2-[[15-[2-(2-hydroxyethylamino)ethyl]-8-oxo-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,9,11,13-heptaen-10-yl]amino]ethyl]-N-methylcarbamate (PubChem CID 15459061) has the molecular formula C25H32N6O4 and a molecular weight of 480.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[15-[2-(2-hydroxyethylamino)ethyl]-8-oxo-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,9,11,13-heptaen-10-yl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[15-[2-(2-hydroxyethylamino)ethyl]-8-oxo-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,9,11,13-heptaen-10-yl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 15459061 |
| Molecular Formula | C25H32N6O4 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | tert-butyl N-[2-[[15-[2-(2-hydroxyethylamino)ethyl]-8-oxo-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,9,11,13-heptaen-10-yl]amino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCNc1ccc2nn(CCNCCO)c3c2c1C(=O)c1ccncc1-3)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H32N6O4/c1-25(2,3)35-24(34)30(4)12-10-28-18-5-6-19-20-21(18)23(33)16-7-8-27-15-17(16)22(20)31(29-19)13-9-26-11-14-32/h5-8,15,26,28,32H,9-14H2,1-4H3 |
| InChIKey | MUJRNCMSQKWACP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|