C22H25NO2S — CID 154591461
2-methyl-N-[1-(4-naphthalen-2-yloxyphenyl)ethyl]propane-2-sulfinamide (PubChem CID 154591461) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is 2-methyl-N-[1-(4-naphthalen-2-yloxyphenyl)ethyl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[1-(4-naphthalen-2-yloxyphenyl)ethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 154591461 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-methyl-N-[1-(4-naphthalen-2-yloxyphenyl)ethyl]propane-2-sulfinamide |
| SMILES | CC(NS(=O)C(C)(C)C)c1ccc(Oc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C22H25NO2S/c1-16(23-26(24)22(2,3)4)17-9-12-20(13-10-17)25-21-14-11-18-7-5-6-8-19(18)15-21/h5-16,23H,1-4H3 |
| InChIKey | OIGPOKPLNUVYMP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |