C44H28N8O2Pt2+4 — CID 154592364
2,7-bis[[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]oxy]-5,10-dipyridin-2-yl-1,6-dihydroindolo[3,2-b]indole-1,6-diide;bis(platinum(2+)) (PubChem CID 154592364) has the molecular formula C44H28N8O2Pt2+4 and a molecular weight of 1090.92 g/mol. Its IUPAC name is 2,7-bis[[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]oxy]-5,10-dipyridin-2-yl-1,6-dihydroindolo[3,2-b]indole-1,6-diide;bis(platinum(2+)).
| Compound Name | 2,7-bis[[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]oxy]-5,10-dipyridin-2-yl-1,6-dihydroindolo[3,2-b]indole-1,6-diide;bis(platinum(2+)) |
|---|---|
| PubChem CID | 154592364 |
| Molecular Formula | C44H28N8O2Pt2+4 |
| Molecular Weight | 1090.92 g/mol |
| Exact Mass | 1090.16 |
| IUPAC Name | 2,7-bis[[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]oxy]-5,10-dipyridin-2-yl-1,6-dihydroindolo[3,2-b]indole-1,6-diide;bis(platinum(2+)) |
| SMILES | C[N+]1=C=[N+](c2[c-]c(Oc3[c-]c4c(cc3)c3c(c5ccc(Oc6[c-]c([N+]7=C=[N+](C)C=C7)ccc6)[c-]c5n3-c3ccccn3)n4-c3ccccn3)ccc2)C=C1.[Pt+2].[Pt+2] |
| InChI | InChI=1S/C44H28N8O2.2Pt/c1-47-21-23-49(29-47)31-9-7-11-33(25-31)53-35-15-17-37-39(27-35)51(41-13-3-5-19-45-41)44-38-18-16-36(28-40(38)52(43(37)44)42-14-4-6-20-46-42)54-34-12-8-10-32(26-34)50-24-22-48(2)30-50;;/h3-24H,1-2H3;;/q;2*+2 |
| InChIKey | SJHLWEOHQLULKH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 66.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1090.92 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|