C56H38N8O2Pt2-6 — CID 154592390
2,7-bis[[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy]-5,10-bis(4-phenyl-2-pyridinyl)-1,6-dihydroindolo[3,2-b]indole-1,6-diide;platinum (PubChem CID 154592390) has the molecular formula C56H38N8O2Pt2-6 and a molecular weight of 1245.13 g/mol. Its IUPAC name is 2,7-bis[[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy]-5,10-bis(4-phenyl-2-pyridinyl)-1,6-dihydroindolo[3,2-b]indole-1,6-diide;platinum.
| Compound Name | 2,7-bis[[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy]-5,10-bis(4-phenyl-2-pyridinyl)-1,6-dihydroindolo[3,2-b]indole-1,6-diide;platinum |
|---|---|
| PubChem CID | 154592390 |
| Molecular Formula | C56H38N8O2Pt2-6 |
| Molecular Weight | 1245.13 g/mol |
| Exact Mass | 1244.24 |
| IUPAC Name | 2,7-bis[[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy]-5,10-bis(4-phenyl-2-pyridinyl)-1,6-dihydroindolo[3,2-b]indole-1,6-diide;platinum |
| SMILES | CN1C=CN(c2[c-]c(Oc3[c-]c4c(cc3)c3c(c5ccc(Oc6[c-]c(N7C=CN(C)[CH-]7)ccc6)[c-]c5n3-c3cc(-c5ccccc5)ccn3)n4-c3cc(-c4ccccc4)ccn3)ccc2)[CH-]1.[Pt].[Pt] |
| InChI | InChI=1S/C56H38N8O2.2Pt/c1-59-27-29-61(37-59)43-15-9-17-45(33-43)65-47-19-21-49-51(35-47)63(53-31-41(23-25-57-53)39-11-5-3-6-12-39)56-50-22-20-48(66-46-18-10-16-44(34-46)62-30-28-60(2)38-62)36-52(50)64(55(49)56)54-32-42(24-26-58-54)40-13-7-4-8-14-40;;/h3-32,37-38H,1-2H3;;/q-6;; |
| InChIKey | LLDLVECOIMLCPC-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 67.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1245.13 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|