C50H28N8O2Pt2 — CID 154592428
2,7-bis[(3-indazol-2-ylbenzene-2-id-1-yl)oxy]-5,10-dipyridin-2-yl-1,6-dihydroindolo[3,2-b]indole-1,6-diide;bis(platinum(2+)) (PubChem CID 154592428) has the molecular formula C50H28N8O2Pt2 and a molecular weight of 1162.98 g/mol. Its IUPAC name is 2,7-bis[(3-indazol-2-ylbenzene-2-id-1-yl)oxy]-5,10-dipyridin-2-yl-1,6-dihydroindolo[3,2-b]indole-1,6-diide;bis(platinum(2+)).
| Compound Name | 2,7-bis[(3-indazol-2-ylbenzene-2-id-1-yl)oxy]-5,10-dipyridin-2-yl-1,6-dihydroindolo[3,2-b]indole-1,6-diide;bis(platinum(2+)) |
|---|---|
| PubChem CID | 154592428 |
| Molecular Formula | C50H28N8O2Pt2 |
| Molecular Weight | 1162.98 g/mol |
| Exact Mass | 1162.16 |
| IUPAC Name | 2,7-bis[(3-indazol-2-ylbenzene-2-id-1-yl)oxy]-5,10-dipyridin-2-yl-1,6-dihydroindolo[3,2-b]indole-1,6-diide;bis(platinum(2+)) |
| SMILES | [Pt+2].[Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2c(c4ccc(Oc5[c-]c(-n6cc7ccccc7n6)ccc5)[c-]c4n2-c2ccccn2)n3-c2ccccn2)cccc1-n1cc2ccccc2n1 |
| InChI | InChI=1S/C50H28N8O2.2Pt/c1-3-17-43-33(11-1)31-55(53-43)35-13-9-15-37(27-35)59-39-21-23-41-45(29-39)57(47-19-5-7-25-51-47)50-42-24-22-40(30-46(42)58(49(41)50)48-20-6-8-26-52-48)60-38-16-10-14-36(28-38)56-32-34-12-2-4-18-44(34)54-56;;/h1-26,31-32H;;/q-4;2*+2 |
| InChIKey | BTEBUZIFQBPPTJ-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 89.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1162.98 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|