C52H50N8O2+2 — CID 154592446
5,10-bis(4-tert-butyl-2-pyridinyl)-2,7-bis[3-(3-methylimidazol-3-ium-1-yl)phenoxy]indolo[3,2-b]indole (PubChem CID 154592446) has the molecular formula C52H50N8O2+2 and a molecular weight of 819.03 g/mol. Its IUPAC name is 5,10-bis(4-tert-butyl-2-pyridinyl)-2,7-bis[3-(3-methylimidazol-3-ium-1-yl)phenoxy]indolo[3,2-b]indole.
| Compound Name | 5,10-bis(4-tert-butyl-2-pyridinyl)-2,7-bis[3-(3-methylimidazol-3-ium-1-yl)phenoxy]indolo[3,2-b]indole |
|---|---|
| PubChem CID | 154592446 |
| Molecular Formula | C52H50N8O2+2 |
| Molecular Weight | 819.03 g/mol |
| Exact Mass | 818.40 |
| IUPAC Name | 5,10-bis(4-tert-butyl-2-pyridinyl)-2,7-bis[3-(3-methylimidazol-3-ium-1-yl)phenoxy]indolo[3,2-b]indole |
| SMILES | C[n+]1ccn(-c2cccc(Oc3ccc4c(c3)n(-c3cc(C(C)(C)C)ccn3)c3c5ccc(Oc6cccc(-n7cc[n+](C)c7)c6)cc5n(-c5cc(C(C)(C)C)ccn5)c43)c2)c1 |
| InChI | InChI=1S/C52H50N8O2/c1-51(2,3)35-19-21-53-47(27-35)59-45-31-41(61-39-13-9-11-37(29-39)57-25-23-55(7)33-57)15-17-43(45)50-49(59)44-18-16-42(62-40-14-10-12-38(30-40)58-26-24-56(8)34-58)32-46(44)60(50)48-28-36(20-22-54-48)52(4,5)6/h9-34H,1-8H3/q+2 |
| InChIKey | TUAHYHCNRLLNPN-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 71.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.03 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|