C18H36N4O6 — CID 15459450
trans-(8S,21S)-8,21-dimethyl-1,4,13,16-tetraoxa-7,10,19,22-tetrazacyclotetracosane-6,23-dione (PubChem CID 15459450) has the molecular formula C18H36N4O6 and a molecular weight of 404.51 g/mol. Its IUPAC name is trans-(8S,21S)-8,21-dimethyl-1,4,13,16-tetraoxa-7,10,19,22-tetrazacyclotetracosane-6,23-dione.
| Compound Name | trans-(8S,21S)-8,21-dimethyl-1,4,13,16-tetraoxa-7,10,19,22-tetrazacyclotetracosane-6,23-dione |
|---|---|
| PubChem CID | 15459450 |
| Molecular Formula | C18H36N4O6 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | trans-(8S,21S)-8,21-dimethyl-1,4,13,16-tetraoxa-7,10,19,22-tetrazacyclotetracosane-6,23-dione |
| SMILES | C[C@H]1CNCCOCCOCCNC[C@H](C)NC(=O)COCCOCC(=O)N1 |
| InChI | InChI=1S/C18H36N4O6/c1-15-11-19-3-5-25-7-8-26-6-4-20-12-16(2)22-18(24)14-28-10-9-27-13-17(23)21-15/h15-16,19-20H,3-14H2,1-2H3,(H,21,23)(H,22,24)/t15-,16-/m0/s1 |
| InChIKey | PTLUPUUUNYGBDF-HOTGVXAUSA-N |
| XLogP | -1.75 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |