C56H33N5OPtS-2 — CID 154594918
4-[3-[3-[3-[2,6-di(carbazol-9-yl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]thieno[3,2-c]pyridine;platinum (PubChem CID 154594918) has the molecular formula C56H33N5OPtS-2 and a molecular weight of 1019.06 g/mol. Its IUPAC name is 4-[3-[3-[3-[2,6-di(carbazol-9-yl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]thieno[3,2-c]pyridine;platinum.
| Compound Name | 4-[3-[3-[3-[2,6-di(carbazol-9-yl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]thieno[3,2-c]pyridine;platinum |
|---|---|
| PubChem CID | 154594918 |
| Molecular Formula | C56H33N5OPtS-2 |
| Molecular Weight | 1019.06 g/mol |
| Exact Mass | 1018.21 |
| IUPAC Name | 4-[3-[3-[3-[2,6-di(carbazol-9-yl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]thieno[3,2-c]pyridine;platinum |
| SMILES | [Pt].[c-]1c(Oc2[c-]c(-n3[c-][n+](-c4c(-n5c6ccccc6c6ccccc65)cccc4-n4c5ccccc5c5ccccc54)c4ccccc43)ccc2)cccc1-c1nccc2sccc12 |
| InChI | InChI=1S/C56H33N5OS.Pt/c1-5-22-46-41(18-1)42-19-2-6-23-47(42)60(46)52-28-13-29-53(61-48-24-7-3-20-43(48)44-21-4-8-25-49(44)61)56(52)59-36-58(50-26-9-10-27-51(50)59)38-15-12-17-40(35-38)62-39-16-11-14-37(34-39)55-45-31-33-63-54(45)30-32-57-55;/h1-33H;/q-2; |
| InChIKey | NKBOSRNQJOMBAF-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 40.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.06 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|