About 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine
4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine (PubChem CID 154595530) has the molecular formula C15H31N3
and a molecular weight of 253.43 g/mol. Its IUPAC name is 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine |
| PubChem CID | 154595530 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine |
| SMILES | CCN(CC)C1CC(C)C(C=NN(C)C)C(C)C1 |
| InChI | InChI=1S/C15H31N3/c1-7-18(8-2)14-9-12(3)15(13(4)10-14)11-16-17(5)6/h11-15H,7-10H2,1-6H3 |
| InChIKey | DBNXMWVSGRJNCX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine?
The IUPAC name of 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine (CID 154595530) is 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine.
What is the SMILES notation for 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine?
The canonical SMILES for 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine is CCN(CC)C1CC(C)C(C=NN(C)C)C(C)C1.
What is the InChIKey of 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine?
The InChIKey is DBNXMWVSGRJNCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3/c1-7-18(8-2)14-9-12(3)15(13(4)10-14)11-16-17(5)6/h11-15H,7-10H2,1-6H3.
What are the key properties of 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine?
4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine has a molecular weight of 253.43 g/mol, XLogP of 2.93, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(dimethylhydrazinylidene)methyl]-N,N-diethyl-3,5-dimethylcyclohexan-1-amine is sourced from PubChem (CID 154595530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).