C40H58N4O4 — CID 154595540
N-[5-[bis(3-cyclopentylpropyl)amino]-2-[(3E)-3-(1-tert-butyl-3-methyl-5-oxopyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]phenyl]-2,2-dimethylbutanamide (PubChem CID 154595540) has the molecular formula C40H58N4O4 and a molecular weight of 658.93 g/mol. Its IUPAC name is N-[5-[bis(3-cyclopentylpropyl)amino]-2-[(3E)-3-(1-tert-butyl-3-methyl-5-oxopyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]phenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[5-[bis(3-cyclopentylpropyl)amino]-2-[(3E)-3-(1-tert-butyl-3-methyl-5-oxopyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]phenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 154595540 |
| Molecular Formula | C40H58N4O4 |
| Molecular Weight | 658.93 g/mol |
| Exact Mass | 658.45 |
| IUPAC Name | N-[5-[bis(3-cyclopentylpropyl)amino]-2-[(3E)-3-(1-tert-butyl-3-methyl-5-oxopyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]phenyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1cc(N(CCCC2CCCC2)CCCC2CCCC2)ccc1C1=C(O)/C(=C2\C(=O)N(C(C)(C)C)N=C2C)C1=O |
| InChI | InChI=1S/C40H58N4O4/c1-8-40(6,7)38(48)41-31-25-29(43(23-13-19-27-15-9-10-16-27)24-14-20-28-17-11-12-18-28)21-22-30(31)33-35(45)34(36(33)46)32-26(2)42-44(37(32)47)39(3,4)5/h21-22,25,27-28,45H,8-20,23-24H2,1-7H3,(H,41,48)/b34-32+ |
| InChIKey | OXLQETLUQJCLCA-NWBJSICCSA-N |
| XLogP | 8.97 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.93 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|