C22H32 — CID 154595702
1,3,5,7-tetrakis(prop-2-enyl)adamantane (PubChem CID 154595702) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 1,3,5,7-tetrakis(prop-2-enyl)adamantane.
| Compound Name | 1,3,5,7-tetrakis(prop-2-enyl)adamantane |
|---|---|
| PubChem CID | 154595702 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1,3,5,7-tetrakis(prop-2-enyl)adamantane |
| SMILES | C=CCC12CC3(CC=C)CC(CC=C)(C1)CC(CC=C)(C2)C3 |
| InChI | InChI=1S/C22H32/c1-5-9-19-13-20(10-6-2)16-21(14-19,11-7-3)18-22(15-19,17-20)12-8-4/h5-8H,1-4,9-18H2 |
| InChIKey | ONHUCHSURIGWER-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|