About N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide
N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide (PubChem CID 154596297) has the molecular formula C16H22F2N2O2
and a molecular weight of 312.36 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide.
Molecular Properties
| Compound Name | N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide |
| PubChem CID | 154596297 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide |
| SMILES | CCC(CC(C)C(=O)Nc1ccccc1)C(=O)NCC(F)F |
| InChI | InChI=1S/C16H22F2N2O2/c1-3-12(16(22)19-10-14(17)18)9-11(2)15(21)20-13-7-5-4-6-8-13/h4-8,11-12,14H,3,9-10H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | FXBIYJQMPWINSJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide?
The IUPAC name of N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide (CID 154596297) is N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide.
What is the SMILES notation for N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide?
The canonical SMILES for N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide is CCC(CC(C)C(=O)Nc1ccccc1)C(=O)NCC(F)F.
What is the InChIKey of N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide?
The InChIKey is FXBIYJQMPWINSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F2N2O2/c1-3-12(16(22)19-10-14(17)18)9-11(2)15(21)20-13-7-5-4-6-8-13/h4-8,11-12,14H,3,9-10H2,1-2H3,(H,19,22)(H,20,21).
What are the key properties of N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide?
N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide has a molecular weight of 312.36 g/mol, XLogP of 3.06, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-difluoroethyl)-4-ethyl-2-methyl-N-phenylpentanediamide is sourced from PubChem (CID 154596297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).