C43H47N4O2+ — CID 154597381
3-[(2E)-2-[(E)-3-[3-(3-hydroxypropyl)-1,1,6-trimethylpyrrolo[2,3-c]carbazol-3-ium-2-yl]prop-2-enylidene]-1,1,6-trimethylpyrrolo[2,3-c]carbazol-3-yl]propan-1-ol (PubChem CID 154597381) has the molecular formula C43H47N4O2+ and a molecular weight of 651.88 g/mol. Its IUPAC name is 3-[(2E)-2-[(E)-3-[3-(3-hydroxypropyl)-1,1,6-trimethylpyrrolo[2,3-c]carbazol-3-ium-2-yl]prop-2-enylidene]-1,1,6-trimethylpyrrolo[2,3-c]carbazol-3-yl]propan-1-ol.
| Compound Name | 3-[(2E)-2-[(E)-3-[3-(3-hydroxypropyl)-1,1,6-trimethylpyrrolo[2,3-c]carbazol-3-ium-2-yl]prop-2-enylidene]-1,1,6-trimethylpyrrolo[2,3-c]carbazol-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 154597381 |
| Molecular Formula | C43H47N4O2+ |
| Molecular Weight | 651.88 g/mol |
| Exact Mass | 651.37 |
| IUPAC Name | 3-[(2E)-2-[(E)-3-[3-(3-hydroxypropyl)-1,1,6-trimethylpyrrolo[2,3-c]carbazol-3-ium-2-yl]prop-2-enylidene]-1,1,6-trimethylpyrrolo[2,3-c]carbazol-3-yl]propan-1-ol |
| SMILES | Cn1c2ccccc2c2c3c(ccc21)[N+](CCCO)=C(/C=C/C=C1/N(CCCO)c2ccc4c(c2C1(C)C)c1ccccc1n4C)C3(C)C |
| InChI | InChI=1S/C43H47N4O2/c1-42(2)36(46(24-12-26-48)34-22-20-32-38(40(34)42)28-14-7-9-16-30(28)44(32)5)18-11-19-37-43(3,4)41-35(47(37)25-13-27-49)23-21-33-39(41)29-15-8-10-17-31(29)45(33)6/h7-11,14-23,48-49H,12-13,24-27H2,1-6H3/q+1 |
| InChIKey | UROBTHFXLGBNEA-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 56.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.88 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|