C21H20F4N6O4 — CID 154597470
[2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-6-(6-morpholin-4-yl-3-pyridinyl)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-5-yl] 2,2,2-trifluoroacetate (PubChem CID 154597470) has the molecular formula C21H20F4N6O4 and a molecular weight of 496.42 g/mol. Its IUPAC name is [2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-6-(6-morpholin-4-yl-3-pyridinyl)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-5-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-6-(6-morpholin-4-yl-3-pyridinyl)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-5-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 154597470 |
| Molecular Formula | C21H20F4N6O4 |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-6-(6-morpholin-4-yl-3-pyridinyl)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-5-yl] 2,2,2-trifluoroacetate |
| SMILES | NC/C(=C\F)Cn1nc2ccc(-c3ccc(N4CCOCC4)nc3)c(OC(=O)C(F)(F)F)n2c1=O |
| InChI | InChI=1S/C21H20F4N6O4/c22-9-13(10-26)12-30-20(33)31-17(28-30)4-2-15(18(31)35-19(32)21(23,24)25)14-1-3-16(27-11-14)29-5-7-34-8-6-29/h1-4,9,11H,5-8,10,12,26H2/b13-9+ |
| InChIKey | FBTVTPQIINWPKK-UKTHLTGXSA-N |
| XLogP | 1.67 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |