C17H17ClN2O4S — CID 154598276
(3S,4S,5S)-5-(5-chlorothiophen-2-yl)-1-[(4-methoxyphenyl)methyl]-3-methyl-4-nitropyrrolidin-2-one (PubChem CID 154598276) has the molecular formula C17H17ClN2O4S and a molecular weight of 380.85 g/mol. Its IUPAC name is (3S,4S,5S)-5-(5-chlorothiophen-2-yl)-1-[(4-methoxyphenyl)methyl]-3-methyl-4-nitropyrrolidin-2-one.
| Compound Name | (3S,4S,5S)-5-(5-chlorothiophen-2-yl)-1-[(4-methoxyphenyl)methyl]-3-methyl-4-nitropyrrolidin-2-one |
|---|---|
| PubChem CID | 154598276 |
| Molecular Formula | C17H17ClN2O4S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | (3S,4S,5S)-5-(5-chlorothiophen-2-yl)-1-[(4-methoxyphenyl)methyl]-3-methyl-4-nitropyrrolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)[C@@H](C)[C@H]([N+](=O)[O-])[C@H]2c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C17H17ClN2O4S/c1-10-15(20(22)23)16(13-7-8-14(18)25-13)19(17(10)21)9-11-3-5-12(24-2)6-4-11/h3-8,10,15-16H,9H2,1-2H3/t10-,15-,16+/m0/s1 |
| InChIKey | NJQGIQUTNJNWCA-CIISACIHSA-N |
| XLogP | 3.78 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|