C28H22F3IrN4 — CID 154599821
iridium(3+);5-phenyl-3-(trifluoromethyl)pyrazol-1-ide;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole (PubChem CID 154599821) has the molecular formula C28H22F3IrN4 and a molecular weight of 663.72 g/mol. Its IUPAC name is iridium(3+);5-phenyl-3-(trifluoromethyl)pyrazol-1-ide;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole.
| Compound Name | iridium(3+);5-phenyl-3-(trifluoromethyl)pyrazol-1-ide;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
|---|---|
| PubChem CID | 154599821 |
| Molecular Formula | C28H22F3IrN4 |
| Molecular Weight | 663.72 g/mol |
| Exact Mass | 664.14 |
| IUPAC Name | iridium(3+);5-phenyl-3-(trifluoromethyl)pyrazol-1-ide;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
| SMILES | Cc1cc(C)c(-n2ccnc2-c2[c-]cccc2)c(C)c1.FC(F)(F)c1cc(-c2[c-]cccc2)[n-]n1.[Ir+3] |
| InChI | InChI=1S/C18H17N2.C10H5F3N2.Ir/c1-13-11-14(2)17(15(3)12-13)20-10-9-19-18(20)16-7-5-4-6-8-16;11-10(12,13)9-6-8(14-15-9)7-4-2-1-3-5-7;/h4-7,9-12H,1-3H3;1-4,6H;/q-1;-2;+3 |
| InChIKey | DNBWPZRWDVLIRB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 44.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|