About 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one
8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 154599933) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
Molecular Properties
| Compound Name | 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| PubChem CID | 154599933 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CC1=NC2(CCN(C(C)(C)C)CC2)C(=O)N1 |
| InChI | InChI=1S/C12H21N3O/c1-9-13-10(16)12(14-9)5-7-15(8-6-12)11(2,3)4/h5-8H2,1-4H3,(H,13,14,16) |
| InChIKey | URCHLFMQEAYIAZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
The IUPAC name of 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (CID 154599933) is 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
What is the SMILES notation for 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
The canonical SMILES for 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one is CC1=NC2(CCN(C(C)(C)C)CC2)C(=O)N1.
What is the InChIKey of 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
The InChIKey is URCHLFMQEAYIAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O/c1-9-13-10(16)12(14-9)5-7-15(8-6-12)11(2,3)4/h5-8H2,1-4H3,(H,13,14,16).
What are the key properties of 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one has a molecular weight of 223.32 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one is sourced from PubChem (CID 154599933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).