About CID 154600625
CID 154600625 (PubChem CID 154600625) has the molecular formula C42H35IrN5O-2
and a molecular weight of 817.99 g/mol.
Molecular Properties
| Compound Name | CID 154600625 |
| PubChem CID | 154600625 |
| Molecular Formula | C42H35IrN5O-2 |
| Molecular Weight | 817.99 g/mol |
| Exact Mass | 818.25 |
| IUPAC Name | — |
| SMILES | CCCCCCc1ccnc(-c2ccn[n-]2)c1.Cn1ccnc1-c1[c-]ccc2c1oc1cc3c4ccccc4c4ccccc4c3cc12.[Ir] |
| InChI | InChI=1S/C28H17N2O.C14H18N3.Ir/c1-30-14-13-29-28(30)22-12-6-11-21-25-15-23-19-9-4-2-7-17(19)18-8-3-5-10-20(18)24(23)16-26(25)31-27(21)22;1-2-3-4-5-6-12-7-9-15-14(11-12)13-8-10-16-17-13;/h2-11,13-16H,1H3;7-11H,2-6H2,1H3;/q2*-1; |
| InChIKey | BZTMQXYYHJFVIP-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 817.99 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 154600625 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154600625?
The IUPAC name of CID 154600625 (CID 154600625) is not available.
What is the SMILES notation for CID 154600625?
The canonical SMILES for CID 154600625 is CCCCCCc1ccnc(-c2ccn[n-]2)c1.Cn1ccnc1-c1[c-]ccc2c1oc1cc3c4ccccc4c4ccccc4c3cc12.[Ir].
What is the InChIKey of CID 154600625?
The InChIKey is BZTMQXYYHJFVIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H17N2O.C14H18N3.Ir/c1-30-14-13-29-28(30)22-12-6-11-21-25-15-23-19-9-4-2-7-17(19)18-8-3-5-10-20(18)24(23)16-26(25)31-27(21)22;1-2-3-4-5-6-12-7-9-15-14(11-12)13-8-10-16-17-13;/h2-11,13-16H,1H3;7-11H,2-6H2,1H3;/q2*-1;.
What are the key properties of CID 154600625?
CID 154600625 has a molecular weight of 817.99 g/mol, XLogP of 10.47, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154600625 is sourced from PubChem (CID 154600625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).